Chemistry 2nd Paper MCQ-Dhaka Board-2017

প্রশ্ন ২৫·সময় ২৫ মিনিট

1. Which one is an electrophilic reagent?

DB 17
ব্যাখ্যা আনলক করতে চর্চা প্রিমিয়াম এ আপগ্রেড করো

2. Which one increases the quality of coal?

DB 17
ব্যাখ্যা আনলক করতে চর্চা প্রিমিয়াম এ আপগ্রেড করো

3. Which element is used as scmiconductor?

DB 17
ব্যাখ্যা আনলক করতে চর্চা প্রিমিয়াম এ আপগ্রেড করো

4. What is the name of the compoundCH3CH(OH)CH(CH3)CHO \mathrm{CH}_{3}-\mathrm{CH}(\mathrm{OH})-\mathrm{CH}\left(\mathrm{CH}_{3}\right)-\mathrm{CHO} ?

DB 17
ব্যাখ্যা আনলক করতে চর্চা প্রিমিয়াম এ আপগ্রেড করো

5. Which is the value of R R is CGS unit?

DB 17
ব্যাখ্যা আনলক করতে চর্চা প্রিমিয়াম এ আপগ্রেড করো

Nothing more to show